C14H24N4O2S2 — CID 54337139
N-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide (PubChem CID 54337139) has the molecular formula C14H24N4O2S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is N-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide.
| Compound Name | N-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54337139 |
| Molecular Formula | C14H24N4O2S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide |
| SMILES | C/N=C(\C[N+](=O)[O-])NCCSCc1cc(C)c(CN(C)C)s1 |
| InChI | InChI=1S/C14H24N4O2S2/c1-11-7-12(22-13(11)8-17(3)4)10-21-6-5-16-14(15-2)9-18(19)20/h7H,5-6,8-10H2,1-4H3,(H,15,16) |
| InChIKey | TWGRXVCCENIDOA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|