C22H29F3N4O2S2 — CID 54376475
N'-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-2-nitro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]ethanimidamide (PubChem CID 54376475) has the molecular formula C22H29F3N4O2S2 and a molecular weight of 502.63 g/mol. Its IUPAC name is N'-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-2-nitro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]ethanimidamide.
| Compound Name | N'-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-2-nitro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]ethanimidamide |
|---|---|
| PubChem CID | 54376475 |
| Molecular Formula | C22H29F3N4O2S2 |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N'-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-2-nitro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]ethanimidamide |
| SMILES | Cc1cc(CSCC/N=C(\C[N+](=O)[O-])NCCc2cccc(C(F)(F)F)c2)sc1CN(C)C |
| InChI | InChI=1S/C22H29F3N4O2S2/c1-16-11-19(33-20(16)13-28(2)3)15-32-10-9-27-21(14-29(30)31)26-8-7-17-5-4-6-18(12-17)22(23,24)25/h4-6,11-12H,7-10,13-15H2,1-3H3,(H,26,27) |
| InChIKey | UWVYAYMFFXIWFN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|