C15H24N4O2S2 — CID 54321345
N-[2-[[5-[[ethyl(methyl)amino]methyl]thiophen-2-yl]methylsulfanyl]ethyl]-4-nitro-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 54321345) has the molecular formula C15H24N4O2S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is N-[2-[[5-[[ethyl(methyl)amino]methyl]thiophen-2-yl]methylsulfanyl]ethyl]-4-nitro-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-[2-[[5-[[ethyl(methyl)amino]methyl]thiophen-2-yl]methylsulfanyl]ethyl]-4-nitro-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 54321345 |
| Molecular Formula | C15H24N4O2S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[2-[[5-[[ethyl(methyl)amino]methyl]thiophen-2-yl]methylsulfanyl]ethyl]-4-nitro-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CCN(C)Cc1ccc(CSCCNC2=NCCC2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C15H24N4O2S2/c1-3-18(2)10-12-4-5-13(23-12)11-22-9-8-17-15-14(19(20)21)6-7-16-15/h4-5,14H,3,6-11H2,1-2H3,(H,16,17) |
| InChIKey | SRXASZKOEXGELV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|