C20H34N4O2S2 — CID 54080684
N-cyclooctyl-N-[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide (PubChem CID 54080684) has the molecular formula C20H34N4O2S2 and a molecular weight of 426.65 g/mol. Its IUPAC name is N-cyclooctyl-N-[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide.
| Compound Name | N-cyclooctyl-N-[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54080684 |
| Molecular Formula | C20H34N4O2S2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-cyclooctyl-N-[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide |
| SMILES | [H]/N=C(\C[N+](=O)[O-])N(CCSCc1ccc(CN(C)C)s1)C1CCCCCCC1 |
| InChI | InChI=1S/C20H34N4O2S2/c1-22(2)14-18-10-11-19(28-18)16-27-13-12-23(20(21)15-24(25)26)17-8-6-4-3-5-7-9-17/h10-11,17,21H,3-9,12-16H2,1-2H3/b21-20+ |
| InChIKey | MMWRNHYWYXZRAT-QZQOTICOSA-N |
| XLogP | 4.71 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|