C22H35N5O2S4 — CID 57277066
N,N'-bis[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide (PubChem CID 57277066) has the molecular formula C22H35N5O2S4 and a molecular weight of 529.82 g/mol. Its IUPAC name is N,N'-bis[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide.
| Compound Name | N,N'-bis[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 57277066 |
| Molecular Formula | C22H35N5O2S4 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N,N'-bis[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide |
| SMILES | CN(C)Cc1ccc(CSCC/N=C(\C[N+](=O)[O-])NCCSCc2ccc(CN(C)C)s2)s1 |
| InChI | InChI=1S/C22H35N5O2S4/c1-25(2)13-18-5-7-20(32-18)16-30-11-9-23-22(15-27(28)29)24-10-12-31-17-21-8-6-19(33-21)14-26(3)4/h5-8H,9-17H2,1-4H3,(H,23,24) |
| InChIKey | CGFCAELVYYZMCF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|