C14H8F2N2O2 — CID 136608358
5-fluoro-6-(4-fluorophenyl)-8-hydroxy-3H-quinazolin-4-one (PubChem CID 136608358) has the molecular formula C14H8F2N2O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5-fluoro-6-(4-fluorophenyl)-8-hydroxy-3H-quinazolin-4-one.
| Compound Name | 5-fluoro-6-(4-fluorophenyl)-8-hydroxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136608358 |
| Molecular Formula | C14H8F2N2O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-fluoro-6-(4-fluorophenyl)-8-hydroxy-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2c(O)cc(-c3ccc(F)cc3)c(F)c12 |
| InChI | InChI=1S/C14H8F2N2O2/c15-8-3-1-7(2-4-8)9-5-10(19)13-11(12(9)16)14(20)18-6-17-13/h1-6,19H,(H,17,18,20) |
| InChIKey | UGXPJYKBYNYOSQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |