C23H27N5O7 — CID 136611205
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(dimethylaminodiazenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 136611205) has the molecular formula C23H27N5O7 and a molecular weight of 485.50 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(dimethylaminodiazenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(dimethylaminodiazenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 136611205 |
| Molecular Formula | C23H27N5O7 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(dimethylaminodiazenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)/N=N/c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C23H27N5O7/c1-27(2)17-11-8-9-7-10-12(25-26-28(3)4)5-6-13(29)15(10)18(30)14(9)20(32)23(11,35)21(33)16(19(17)31)22(24)34/h5-6,9,11,14,16-17,29,35H,7-8H2,1-4H3,(H2,24,34)/b26-25+/t9-,11-,14?,16?,17-,23-/m0/s1 |
| InChIKey | XZUXWJSUAFOUCE-OKOXEXGKSA-N |
| XLogP | -0.57 |
| TPSA | 183.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|