C48H57BClN2O8S2 — CID 136611321
CID 136611321 (PubChem CID 136611321) has the molecular formula C48H57BClN2O8S2 and a molecular weight of 900.39 g/mol.
| Compound Name | CID 136611321 |
|---|---|
| PubChem CID | 136611321 |
| Molecular Formula | C48H57BClN2O8S2 |
| Molecular Weight | 900.39 g/mol |
| Exact Mass | 899.33 |
| IUPAC Name | — |
| SMILES | CC1(C)C(=CC=C2CCCC(C=CC3=[N+](CCCCS(=O)(=O)O)c4ccc5ccccc5c4C3(C)C)=C2Cl)N(CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21.CCO[B]O |
| InChI | InChI=1S/C46H51ClN2O6S2.C2H6BO2/c1-45(2)40(48(28-9-11-30-56(50,51)52)38-24-20-32-14-5-7-18-36(32)42(38)45)26-22-34-16-13-17-35(44(34)47)23-27-41-46(3,4)43-37-19-8-6-15-33(37)21-25-39(43)49(41)29-10-12-31-57(53,54)55;1-2-5-3-4/h5-8,14-15,18-27H,9-13,16-17,28-31H2,1-4H3,(H-,50,51,52,53,54,55);4H,2H2,1H3 |
| InChIKey | QDFAKXRIILJFDV-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.39 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|