C101H115BClN4O16S4 — CID 159207389
CID 159207389 (PubChem CID 159207389) has the molecular formula C101H115BClN4O16S4 and a molecular weight of 1815.58 g/mol.
| Compound Name | CID 159207389 |
|---|---|
| PubChem CID | 159207389 |
| Molecular Formula | C101H115BClN4O16S4 |
| Molecular Weight | 1815.58 g/mol |
| Exact Mass | 1813.70 |
| IUPAC Name | — |
| SMILES | CC1(C)C(/C=C/C2=C(c3ccc(C(=O)O)cc3)C(C/C=C3\N(CCCCS(=O)(=O)O)c4ccc5ccccc5c4C3(C)C)CCC2)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21.CC1(C)C(=CC=C2CCCC(C=CC3=[N+](CCCCS(=O)(=O)O)c4ccc5ccccc5c4C3(C)C)=C2Cl)N(CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21.CCO[B]O |
| InChI | InChI=1S/C53H58N2O8S2.C46H51ClN2O6S2.C2H6BO2/c1-52(2)46(54(32-9-11-34-64(58,59)60)44-28-24-36-14-5-7-18-42(36)49(44)52)30-26-38-16-13-17-39(48(38)40-20-22-41(23-21-40)51(56)57)27-31-47-53(3,4)50-43-19-8-6-15-37(43)25-29-45(50)55(47)33-10-12-35-65(61,62)63;1-45(2)40(48(28-9-11-30-56(50,51)52)38-24-20-32-14-5-7-18-36(32)42(38)45)26-22-34-16-13-17-35(44(34)47)23-27-41-46(3,4)43-37-19-8-6-15-33(37)21-25-39(43)49(41)29-10-12-31-57(53,54)55;1-2-5-3-4/h5-8,14-15,18-26,28-31,39H,9-13,16-17,27,32-35H2,1-4H3,(H2-,56,57,58,59,60,61,62,63);5-8,14-15,18-27H,9-13,16-17,28-31H2,1-4H3,(H-,50,51,52,53,54,55);4H,2H2,1H3/b30-26+,47-31-;; |
| InChIKey | PASJGNWRKVYGIQ-ZOJGDPDHSA-N |
| XLogP | 20.70 |
| TPSA | 302.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 127 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1815.58 |
| LogP ≤ 5 | 20.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|