C21H28N6OS — CID 136611498
2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]-5-(1H-pyrazol-4-yl)phenol (PubChem CID 136611498) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 136611498 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]-5-(1H-pyrazol-4-yl)phenol |
| SMILES | CN(c1nnc(-c2ccc(-c3cn[nH]c3)cc2O)s1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H28N6OS/c1-20(2)9-15(10-21(3,4)26-20)27(5)19-25-24-18(29-19)16-7-6-13(8-17(16)28)14-11-22-23-12-14/h6-8,11-12,15,26,28H,9-10H2,1-5H3,(H,22,23) |
| InChIKey | ZLUVGMCESLKISW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |