C22H30N6OS — CID 90282441
5-[2-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90282441) has the molecular formula C22H30N6OS and a molecular weight of 426.59 g/mol. Its IUPAC name is 5-[2-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90282441 |
| Molecular Formula | C22H30N6OS |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-[2-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cc(-c2cn[nH]c2)ccc1-c1nnc(N(C)C2CC(C)(C)NC(C)(C)C2)s1 |
| InChI | InChI=1S/C22H30N6OS/c1-21(2)10-16(11-22(3,4)27-21)28(5)20-26-25-19(30-20)17-8-7-14(9-18(17)29-6)15-12-23-24-13-15/h7-9,12-13,16,27H,10-11H2,1-6H3,(H,23,24) |
| InChIKey | SAHINCITBDZACY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |