C26H18ClF4N7O3S — CID 136612403
1-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-fluoro-7-hydroxy-3,3-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2H-indol-1-yl]phenyl]urea (PubChem CID 136612403) has the molecular formula C26H18ClF4N7O3S and a molecular weight of 619.99 g/mol. Its IUPAC name is 1-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-fluoro-7-hydroxy-3,3-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2H-indol-1-yl]phenyl]urea.
| Compound Name | 1-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-fluoro-7-hydroxy-3,3-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2H-indol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 136612403 |
| Molecular Formula | C26H18ClF4N7O3S |
| Molecular Weight | 619.99 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | 1-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-fluoro-7-hydroxy-3,3-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2H-indol-1-yl]phenyl]urea |
| SMILES | CC1(C)CN(c2ccccc2NC(=O)Nc2nc3ccc(Cl)nc3s2)c2c(O)cc(F)c(-c3noc(C(F)(F)F)n3)c21 |
| InChI | InChI=1S/C26H18ClF4N7O3S/c1-25(2)10-38(19-15(39)9-11(28)17(18(19)25)20-35-22(41-37-20)26(29,30)31)14-6-4-3-5-12(14)32-23(40)36-24-33-13-7-8-16(27)34-21(13)42-24/h3-9,39H,10H2,1-2H3,(H2,32,33,36,40) |
| InChIKey | LIFQNNPEVCWLBJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.99 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|