C26H30N4O3S — CID 136616634
5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-2-(1-phenylethylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 136616634) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-2-(1-phenylethylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-2-(1-phenylethylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136616634 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-2-(1-phenylethylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cc3c(C)nc(SC(C)c4ccccc4)[nH]c3=O)CC2)cc1 |
| InChI | InChI=1S/C26H30N4O3S/c1-18-23(25(32)28-26(27-18)34-19(2)20-7-5-4-6-8-20)17-24(31)30-15-13-29(14-16-30)21-9-11-22(33-3)12-10-21/h4-12,19H,13-17H2,1-3H3,(H,27,28,32) |
| InChIKey | ZNUWYZWQMANHCE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|