C15H11F3N2O — CID 136617752
4-(1H-indazol-6-yl)-3-(2,2,2-trifluoroethyl)phenol (PubChem CID 136617752) has the molecular formula C15H11F3N2O and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-(1H-indazol-6-yl)-3-(2,2,2-trifluoroethyl)phenol.
| Compound Name | 4-(1H-indazol-6-yl)-3-(2,2,2-trifluoroethyl)phenol |
|---|---|
| PubChem CID | 136617752 |
| Molecular Formula | C15H11F3N2O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-(1H-indazol-6-yl)-3-(2,2,2-trifluoroethyl)phenol |
| SMILES | Oc1ccc(-c2ccc3cn[nH]c3c2)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3N2O/c16-15(17,18)7-11-5-12(21)3-4-13(11)9-1-2-10-8-19-20-14(10)6-9/h1-6,8,21H,7H2,(H,19,20) |
| InChIKey | GHOXDJBNHJJYIH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |