C17H19FN4O3S — CID 136901416
4-(dimethylsulfamoylamino)-6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazole (PubChem CID 136901416) has the molecular formula C17H19FN4O3S and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-(dimethylsulfamoylamino)-6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazole.
| Compound Name | 4-(dimethylsulfamoylamino)-6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazole |
|---|---|
| PubChem CID | 136901416 |
| Molecular Formula | C17H19FN4O3S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-(dimethylsulfamoylamino)-6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazole |
| SMILES | CCc1cc(O)c(F)cc1-c1cc(NS(=O)(=O)N(C)C)c2cn[nH]c2c1 |
| InChI | InChI=1S/C17H19FN4O3S/c1-4-10-7-17(23)14(18)8-12(10)11-5-15-13(9-19-20-15)16(6-11)21-26(24,25)22(2)3/h5-9,21,23H,4H2,1-3H3,(H,19,20) |
| InChIKey | QHSGPVFWACSQCJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |