C19H20FN3O5S — CID 155540621
methyl 3-[[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-4-yl]sulfamoyl]propanoate (PubChem CID 155540621) has the molecular formula C19H20FN3O5S and a molecular weight of 421.45 g/mol. Its IUPAC name is methyl 3-[[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-4-yl]sulfamoyl]propanoate.
| Compound Name | methyl 3-[[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-4-yl]sulfamoyl]propanoate |
|---|---|
| PubChem CID | 155540621 |
| Molecular Formula | C19H20FN3O5S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 3-[[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-4-yl]sulfamoyl]propanoate |
| SMILES | CCc1cc(O)c(F)cc1-c1cc(NS(=O)(=O)CCC(=O)OC)c2cn[nH]c2c1 |
| InChI | InChI=1S/C19H20FN3O5S/c1-3-11-8-18(24)15(20)9-13(11)12-6-16-14(10-21-22-16)17(7-12)23-29(26,27)5-4-19(25)28-2/h6-10,23-24H,3-5H2,1-2H3,(H,21,22) |
| InChIKey | AYLMOPXFFHJMMR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |