C22H27F2N9O — CID 136619670
4-[[4-[[(7R,8aR)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl]amino]-5-fluoropyrimidin-2-yl]amino]-5-fluoro-2-(5-methyltetrazol-1-yl)phenol (PubChem CID 136619670) has the molecular formula C22H27F2N9O and a molecular weight of 471.52 g/mol. Its IUPAC name is 4-[[4-[[(7R,8aR)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl]amino]-5-fluoropyrimidin-2-yl]amino]-5-fluoro-2-(5-methyltetrazol-1-yl)phenol.
| Compound Name | 4-[[4-[[(7R,8aR)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl]amino]-5-fluoropyrimidin-2-yl]amino]-5-fluoro-2-(5-methyltetrazol-1-yl)phenol |
|---|---|
| PubChem CID | 136619670 |
| Molecular Formula | C22H27F2N9O |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[[4-[[(7R,8aR)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl]amino]-5-fluoropyrimidin-2-yl]amino]-5-fluoro-2-(5-methyltetrazol-1-yl)phenol |
| SMILES | Cc1nnnn1-c1cc(Nc2ncc(F)c(N[C@@H]3C[C@H]4CCCN4C(C)(C)C3)n2)c(F)cc1O |
| InChI | InChI=1S/C22H27F2N9O/c1-12-29-30-31-33(12)18-9-17(15(23)8-19(18)34)27-21-25-11-16(24)20(28-21)26-13-7-14-5-4-6-32(14)22(2,3)10-13/h8-9,11,13-14,34H,4-7,10H2,1-3H3,(H2,25,26,27,28)/t13-,14-/m1/s1 |
| InChIKey | QLYWBQDSYLGAOY-ZIAGYGMSSA-N |
| XLogP | 3.31 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|