C26H33FN10O — CID 123177174
1-[5-[[5-cyano-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorophenyl]-1-diazenyl-3-methylurea (PubChem CID 123177174) has the molecular formula C26H33FN10O and a molecular weight of 520.62 g/mol. Its IUPAC name is 1-[5-[[5-cyano-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorophenyl]-1-diazenyl-3-methylurea.
| Compound Name | 1-[5-[[5-cyano-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorophenyl]-1-diazenyl-3-methylurea |
|---|---|
| PubChem CID | 123177174 |
| Molecular Formula | C26H33FN10O |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 1-[5-[[5-cyano-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorophenyl]-1-diazenyl-3-methylurea |
| SMILES | [H]/N=N/N(C(=O)NC)c1cc(Nc2ncc(C#N)c(NC3CC4CCCN4C(C)(C)C3)n2)c(F)cc1C1CC1 |
| InChI | InChI=1S/C26H33FN10O/c1-26(2)12-17(9-18-5-4-8-36(18)26)32-23-16(13-28)14-31-24(34-23)33-21-11-22(37(35-29)25(38)30-3)19(10-20(21)27)15-6-7-15/h10-11,14-15,17-18,29H,4-9,12H2,1-3H3,(H,30,38)(H2,31,32,33,34)/b35-29+ |
| InChIKey | ZDHDGARBGJFYJZ-OZMGXUMRSA-N |
| XLogP | 5.02 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|