C24H33F2N9 — CID 123652717
N-[2-cyclopropyl-4-fluoro-5-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-diazenylmethanimidamide (PubChem CID 123652717) has the molecular formula C24H33F2N9 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[2-cyclopropyl-4-fluoro-5-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-diazenylmethanimidamide.
| Compound Name | N-[2-cyclopropyl-4-fluoro-5-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-diazenylmethanimidamide |
|---|---|
| PubChem CID | 123652717 |
| Molecular Formula | C24H33F2N9 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | N-[2-cyclopropyl-4-fluoro-5-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-N-diazenylmethanimidamide |
| SMILES | [H]/N=C/N(/N=N/[H])c1cc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)c(F)cc1C1CC1 |
| InChI | InChI=1S/C24H33F2N9/c1-23(2)10-15(11-24(3,4)34(23)5)30-21-18(26)12-29-22(32-21)31-19-9-20(35(13-27)33-28)16(8-17(19)25)14-6-7-14/h8-9,12-15,27-28H,6-7,10-11H2,1-5H3,(H2,29,30,31,32)/b27-13+,33-28+ |
| InChIKey | RLPZHYWHAYNQEG-FOVQUJHKSA-N |
| XLogP | 5.80 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|