C21H21N3O3 — CID 136624987
N-[3,5-bis(4-hydroxyphenyl)pyrazin-2-yl]-2-methylbutanamide (PubChem CID 136624987) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[3,5-bis(4-hydroxyphenyl)pyrazin-2-yl]-2-methylbutanamide.
| Compound Name | N-[3,5-bis(4-hydroxyphenyl)pyrazin-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 136624987 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[3,5-bis(4-hydroxyphenyl)pyrazin-2-yl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1ncc(-c2ccc(O)cc2)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-3-13(2)21(27)24-20-19(15-6-10-17(26)11-7-15)23-18(12-22-20)14-4-8-16(25)9-5-14/h4-13,25-26H,3H2,1-2H3,(H,22,24,27) |
| InChIKey | QHDVMWIBNHTGSJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |