C19H22N4OS — CID 89009470
N-[5-(4-aminophenyl)-3-(2,3-dihydrothiophen-2-yl)pyrazin-2-yl]-2-methylbutanamide (PubChem CID 89009470) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[5-(4-aminophenyl)-3-(2,3-dihydrothiophen-2-yl)pyrazin-2-yl]-2-methylbutanamide.
| Compound Name | N-[5-(4-aminophenyl)-3-(2,3-dihydrothiophen-2-yl)pyrazin-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 89009470 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[5-(4-aminophenyl)-3-(2,3-dihydrothiophen-2-yl)pyrazin-2-yl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1ncc(-c2ccc(N)cc2)nc1C1CC=CS1 |
| InChI | InChI=1S/C19H22N4OS/c1-3-12(2)19(24)23-18-17(16-5-4-10-25-16)22-15(11-21-18)13-6-8-14(20)9-7-13/h4,6-12,16H,3,5,20H2,1-2H3,(H,21,23,24) |
| InChIKey | QIPMLAAIHRWHKE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|