C18H22N4O — CID 89009592
N-(8-amino-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-methylbutanamide (PubChem CID 89009592) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(8-amino-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-methylbutanamide.
| Compound Name | N-(8-amino-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 89009592 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-(8-amino-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1nc2c(nc1C)-c1ccc(N)cc1CC2 |
| InChI | InChI=1S/C18H22N4O/c1-4-10(2)18(23)22-17-11(3)20-16-14-7-6-13(19)9-12(14)5-8-15(16)21-17/h6-7,9-10H,4-5,8,19H2,1-3H3,(H,21,22,23) |
| InChIKey | QMYRTSFQSILFLH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|