C26H22N4O2 — CID 136625501
N-[8-amino-2-(4-hydroxyphenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-phenylacetamide (PubChem CID 136625501) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[8-amino-2-(4-hydroxyphenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-phenylacetamide.
| Compound Name | N-[8-amino-2-(4-hydroxyphenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 136625501 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[8-amino-2-(4-hydroxyphenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-phenylacetamide |
| SMILES | Nc1ccc2c(c1)CCc1nc(NC(=O)Cc3ccccc3)c(-c3ccc(O)cc3)nc1-2 |
| InChI | InChI=1S/C26H22N4O2/c27-19-9-12-21-18(15-19)8-13-22-25(21)30-24(17-6-10-20(31)11-7-17)26(28-22)29-23(32)14-16-4-2-1-3-5-16/h1-7,9-12,15,31H,8,13-14,27H2,(H,28,29,32) |
| InChIKey | PZRYNOASPKRZCA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|