C28H23ClN4O — CID 77496858
N-[8-amino-2-(2-phenylethenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-(4-chlorophenyl)acetamide (PubChem CID 77496858) has the molecular formula C28H23ClN4O and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[8-amino-2-(2-phenylethenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[8-amino-2-(2-phenylethenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 77496858 |
| Molecular Formula | C28H23ClN4O |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[8-amino-2-(2-phenylethenyl)-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-(4-chlorophenyl)acetamide |
| SMILES | Nc1ccc2c(c1)CCc1nc(NC(=O)Cc3ccc(Cl)cc3)c(C=Cc3ccccc3)nc1-2 |
| InChI | InChI=1S/C28H23ClN4O/c29-21-10-6-19(7-11-21)16-26(34)33-28-25(14-8-18-4-2-1-3-5-18)31-27-23-13-12-22(30)17-20(23)9-15-24(27)32-28/h1-8,10-14,17H,9,15-16,30H2,(H,32,33,34) |
| InChIKey | TWRXNLCVOBDOQD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|