C22H16Cl2N2O2 — CID 136627753
1-chloro-3-[(2-chlorophenyl)methyl]-5-(4-hydroxyphenyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 136627753) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 1-chloro-3-[(2-chlorophenyl)methyl]-5-(4-hydroxyphenyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | 1-chloro-3-[(2-chlorophenyl)methyl]-5-(4-hydroxyphenyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 136627753 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 1-chloro-3-[(2-chlorophenyl)methyl]-5-(4-hydroxyphenyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1C(Cc2ccccc2Cl)N=C(c2ccc(O)cc2)c2ccccc2N1Cl |
| InChI | InChI=1S/C22H16Cl2N2O2/c23-18-7-3-1-5-15(18)13-19-22(28)26(24)20-8-4-2-6-17(20)21(25-19)14-9-11-16(27)12-10-14/h1-12,19,27H,13H2 |
| InChIKey | SWLVDCJTPIKDFP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|