C24H27ClN4O5S — CID 136629743
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7,8,9-tetrahydropurin-8-yl)sulfanyl]oxane-2,4-dione (PubChem CID 136629743) has the molecular formula C24H27ClN4O5S and a molecular weight of 519.02 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7,8,9-tetrahydropurin-8-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7,8,9-tetrahydropurin-8-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136629743 |
| Molecular Formula | C24H27ClN4O5S |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7,8,9-tetrahydropurin-8-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(SC3Nc4nc[nH]c(=O)c4N3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C24H27ClN4O5S/c1-33-17-7-6-13(10-15(17)25)8-9-24(14-4-2-3-5-14)11-16(30)19(22(32)34-24)35-23-28-18-20(29-23)26-12-27-21(18)31/h6-7,10,12,14,19,23,28H,2-5,8-9,11H2,1H3,(H2,26,27,29,31) |
| InChIKey | AXFGLHQBTCPBRJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|