C26H31ClN4O4S — CID 10482145
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione (PubChem CID 10482145) has the molecular formula C26H31ClN4O4S and a molecular weight of 531.08 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 10482145 |
| Molecular Formula | C26H31ClN4O4S |
| Molecular Weight | 531.08 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(SC3=NC4N=C(C)C=C(C)N4N3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C26H31ClN4O4S/c1-15-12-16(2)31-24(28-15)29-25(30-31)36-22-20(32)14-26(35-23(22)33,18-6-4-5-7-18)11-10-17-8-9-21(34-3)19(27)13-17/h8-9,12-13,18,22,24H,4-7,10-11,14H2,1-3H3,(H,29,30) |
| InChIKey | LNANRHKFXXJMSU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.08 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|