C32H36N4O4S — CID 91462054
6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(4-phenylmethoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 91462054) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(4-phenylmethoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(4-phenylmethoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91462054 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(4-phenylmethoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | CC1=CC(C)=NC2N=C(SC3C(=O)CC(CCc4ccc(OCc5ccccc5)cc4)(C4CCCC4)OC3=O)NN12 |
| InChI | InChI=1S/C32H36N4O4S/c1-21-18-22(2)36-30(33-21)34-31(35-36)41-28-27(37)19-32(40-29(28)38,25-10-6-7-11-25)17-16-23-12-14-26(15-13-23)39-20-24-8-4-3-5-9-24/h3-5,8-9,12-15,18,25,28,30H,6-7,10-11,16-17,19-20H2,1-2H3,(H,34,35) |
| InChIKey | DQGFQAMHGZMQTI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|