C32H36N4O4S — CID 54718869
2-cyclopentyl-5-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-4-hydroxy-2-[2-(4-phenylmethoxyphenyl)ethyl]-3H-pyran-6-one (PubChem CID 54718869) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is 2-cyclopentyl-5-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-4-hydroxy-2-[2-(4-phenylmethoxyphenyl)ethyl]-3H-pyran-6-one.
| Compound Name | 2-cyclopentyl-5-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-4-hydroxy-2-[2-(4-phenylmethoxyphenyl)ethyl]-3H-pyran-6-one |
|---|---|
| PubChem CID | 54718869 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-cyclopentyl-5-[(5,7-dimethyl-1,3a-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-4-hydroxy-2-[2-(4-phenylmethoxyphenyl)ethyl]-3H-pyran-6-one |
| SMILES | CC1=CC(C)=NC2N=C(SC3=C(O)CC(CCc4ccc(OCc5ccccc5)cc4)(C4CCCC4)OC3=O)NN12 |
| InChI | InChI=1S/C32H36N4O4S/c1-21-18-22(2)36-30(33-21)34-31(35-36)41-28-27(37)19-32(40-29(28)38,25-10-6-7-11-25)17-16-23-12-14-26(15-13-23)39-20-24-8-4-3-5-9-24/h3-5,8-9,12-15,18,25,30,37H,6-7,10-11,16-17,19-20H2,1-2H3,(H,34,35) |
| InChIKey | WXJALCJTTLCZJT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |