C19H19ClFN5O3 — CID 136629883
[(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] (11S,14S)-6-fluoro-2-oxo-1,5-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate (PubChem CID 136629883) has the molecular formula C19H19ClFN5O3 and a molecular weight of 419.84 g/mol. Its IUPAC name is [(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] (11S,14S)-6-fluoro-2-oxo-1,5-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate.
| Compound Name | [(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] (11S,14S)-6-fluoro-2-oxo-1,5-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate |
|---|---|
| PubChem CID | 136629883 |
| Molecular Formula | C19H19ClFN5O3 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] (11S,14S)-6-fluoro-2-oxo-1,5-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate |
| SMILES | N/C(=N\OC(=O)[C@H]1CC[C@H]2CCc3cc(F)ncc3C(=O)N2C1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C19H19ClFN5O3/c20-12-6-15(23-7-12)17(22)25-29-19(28)11-2-4-13-3-1-10-5-16(21)24-8-14(10)18(27)26(13)9-11/h5-8,11,13,23H,1-4,9H2,(H2,22,25)/t11-,13+/m0/s1 |
| InChIKey | PANHVNHDORNGJR-WCQYABFASA-N |
| XLogP | 2.23 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|