C30H30N4O4S — CID 136631584
3-(3,3-dimethyl-2-methylidenebutyl)-6-ethyl-1-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 136631584) has the molecular formula C30H30N4O4S and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2-methylidenebutyl)-6-ethyl-1-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(3,3-dimethyl-2-methylidenebutyl)-6-ethyl-1-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136631584 |
| Molecular Formula | C30H30N4O4S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 3-(3,3-dimethyl-2-methylidenebutyl)-6-ethyl-1-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | C=C(Cn1c(=O)c2cc(CC)sc2n(Cc2ccc(-c3ccccc3-c3noc(=O)[nH]3)cc2)c1=O)C(C)(C)C |
| InChI | InChI=1S/C30H30N4O4S/c1-6-21-15-24-26(35)33(16-18(2)30(3,4)5)29(37)34(27(24)39-21)17-19-11-13-20(14-12-19)22-9-7-8-10-23(22)25-31-28(36)38-32-25/h7-15H,2,6,16-17H2,1,3-5H3,(H,31,32,36) |
| InChIKey | UFNVEQCVDKEKMX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|