C30H34KN4O4 — CID 162167558
CID 162167558 (PubChem CID 162167558) has the molecular formula C30H34KN4O4 and a molecular weight of 553.72 g/mol.
| Compound Name | CID 162167558 |
|---|---|
| PubChem CID | 162167558 |
| Molecular Formula | C30H34KN4O4 |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | — |
| SMILES | CCCCc1nc(C)n(CC(=O)C(C)(C)C)c(=O)c1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1.[K] |
| InChI | InChI=1S/C30H34N4O4.K/c1-6-7-12-25-24(28(36)34(19(2)31-25)18-26(35)30(3,4)5)17-20-13-15-21(16-14-20)22-10-8-9-11-23(22)27-32-29(37)38-33-27;/h8-11,13-16H,6-7,12,17-18H2,1-5H3,(H,32,33,37); |
| InChIKey | ZNILXFMSINKOAD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |