C29H32N4NaO4 — CID 172803114
CID 172803114 (PubChem CID 172803114) has the molecular formula C29H32N4NaO4 and a molecular weight of 523.59 g/mol.
| Compound Name | CID 172803114 |
|---|---|
| PubChem CID | 172803114 |
| Molecular Formula | C29H32N4NaO4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | — |
| SMILES | CCCc1nc(C)n(CC2CCCCO2)c(=O)c1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1.[Na] |
| InChI | InChI=1S/C29H32N4O4.Na/c1-3-8-26-25(28(34)33(19(2)30-26)18-22-9-6-7-16-36-22)17-20-12-14-21(15-13-20)23-10-4-5-11-24(23)27-31-29(35)37-32-27;/h4-5,10-15,22H,3,6-9,16-18H2,1-2H3,(H,31,32,35); |
| InChIKey | RDGPOHDZGZGJQP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |