About 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol
2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol (PubChem CID 136631599) has the molecular formula C20H21N3O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol |
| PubChem CID | 136631599 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol |
| SMILES | Cn1c(-c2ccc(O)cc2)nc2c1CN(Cc1ccccc1O)CC2 |
| InChI | InChI=1S/C20H21N3O2/c1-22-18-13-23(12-15-4-2-3-5-19(15)25)11-10-17(18)21-20(22)14-6-8-16(24)9-7-14/h2-9,24-25H,10-13H2,1H3 |
| InChIKey | IHPLVWJBQMLKMA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol?
The IUPAC name of 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol (CID 136631599) is 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol.
What is the SMILES notation for 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol?
The canonical SMILES for 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol is Cn1c(-c2ccc(O)cc2)nc2c1CN(Cc1ccccc1O)CC2.
What is the InChIKey of 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol?
The InChIKey is IHPLVWJBQMLKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O2/c1-22-18-13-23(12-15-4-2-3-5-19(15)25)11-10-17(18)21-20(22)14-6-8-16(24)9-7-14/h2-9,24-25H,10-13H2,1H3.
What are the key properties of 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol?
2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol has a molecular weight of 335.41 g/mol, XLogP of 3.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-hydroxyphenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]methyl]phenol is sourced from PubChem (CID 136631599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).