C25H27N3O2 — CID 143944114
[(E)-but-2-en-2-yl] 4-[(3-methyl-2-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)methyl]benzoate (PubChem CID 143944114) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl] 4-[(3-methyl-2-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)methyl]benzoate.
| Compound Name | [(E)-but-2-en-2-yl] 4-[(3-methyl-2-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)methyl]benzoate |
|---|---|
| PubChem CID | 143944114 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | [(E)-but-2-en-2-yl] 4-[(3-methyl-2-phenyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)methyl]benzoate |
| SMILES | C/C=C(\C)OC(=O)c1ccc(CN2CCc3nc(-c4ccccc4)n(C)c3C2)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-4-18(2)30-25(29)21-12-10-19(11-13-21)16-28-15-14-22-23(17-28)27(3)24(26-22)20-8-6-5-7-9-20/h4-13H,14-17H2,1-3H3/b18-4+ |
| InChIKey | PSJNGOHTRFHUFS-JJPRUIFNSA-N |
| XLogP | 4.73 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|