C26H39FN4O4 — CID 136631834
2-(1,3-dioxan-2-yl)-N-[4-[2-[4-(4-fluoro-2-hydroxy-5-methylbenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]acetamide (PubChem CID 136631834) has the molecular formula C26H39FN4O4 and a molecular weight of 490.62 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)-N-[4-[2-[4-(4-fluoro-2-hydroxy-5-methylbenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(1,3-dioxan-2-yl)-N-[4-[2-[4-(4-fluoro-2-hydroxy-5-methylbenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 136631834 |
| Molecular Formula | C26H39FN4O4 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)-N-[4-[2-[4-(4-fluoro-2-hydroxy-5-methylbenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]acetamide |
| SMILES | [H]/N=C(/c1cc(C)c(F)cc1O)N1CCN(CCC2CCC(NC(=O)CC3OCCCO3)CC2)CC1 |
| InChI | InChI=1S/C26H39FN4O4/c1-18-15-21(23(32)16-22(18)27)26(28)31-11-9-30(10-12-31)8-7-19-3-5-20(6-4-19)29-24(33)17-25-34-13-2-14-35-25/h15-16,19-20,25,28,32H,2-14,17H2,1H3,(H,29,33)/b28-26- |
| InChIKey | LMWYRUZCBOYPGK-SGEDCAFJSA-N |
| XLogP | 3.00 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|