C27H42FN5O3 — CID 136627923
N-[4-[2-[4-(5-fluoro-2-hydroxybenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]-2-(4-methoxypiperidin-1-yl)acetamide (PubChem CID 136627923) has the molecular formula C27H42FN5O3 and a molecular weight of 503.66 g/mol. Its IUPAC name is N-[4-[2-[4-(5-fluoro-2-hydroxybenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]-2-(4-methoxypiperidin-1-yl)acetamide.
| Compound Name | N-[4-[2-[4-(5-fluoro-2-hydroxybenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]-2-(4-methoxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 136627923 |
| Molecular Formula | C27H42FN5O3 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | N-[4-[2-[4-(5-fluoro-2-hydroxybenzenecarboximidoyl)piperazin-1-yl]ethyl]cyclohexyl]-2-(4-methoxypiperidin-1-yl)acetamide |
| SMILES | [H]/N=C(/c1cc(F)ccc1O)N1CCN(CCC2CCC(NC(=O)CN3CCC(OC)CC3)CC2)CC1 |
| InChI | InChI=1S/C27H42FN5O3/c1-36-23-9-12-32(13-10-23)19-26(35)30-22-5-2-20(3-6-22)8-11-31-14-16-33(17-15-31)27(29)24-18-21(28)4-7-25(24)34/h4,7,18,20,22-23,29,34H,2-3,5-6,8-17,19H2,1H3,(H,30,35)/b29-27- |
| InChIKey | CMBNMITXYVKWFY-OHYPFYFLSA-N |
| XLogP | 2.65 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|