C30H37F2N5O2 — CID 143994337
(Z)-N-(1-benzylpiperidin-4-yl)-2-[[1-[(3,6-difluoro-2-hydroxyphenyl)methyl]-3-propan-2-ylidenepiperazin-2-ylidene]amino]but-2-enamide (PubChem CID 143994337) has the molecular formula C30H37F2N5O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is (Z)-N-(1-benzylpiperidin-4-yl)-2-[[1-[(3,6-difluoro-2-hydroxyphenyl)methyl]-3-propan-2-ylidenepiperazin-2-ylidene]amino]but-2-enamide.
| Compound Name | (Z)-N-(1-benzylpiperidin-4-yl)-2-[[1-[(3,6-difluoro-2-hydroxyphenyl)methyl]-3-propan-2-ylidenepiperazin-2-ylidene]amino]but-2-enamide |
|---|---|
| PubChem CID | 143994337 |
| Molecular Formula | C30H37F2N5O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (Z)-N-(1-benzylpiperidin-4-yl)-2-[[1-[(3,6-difluoro-2-hydroxyphenyl)methyl]-3-propan-2-ylidenepiperazin-2-ylidene]amino]but-2-enamide |
| SMILES | C/C=C(\N=C1\C(=C(C)C)NCCN1Cc1c(F)ccc(F)c1O)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H37F2N5O2/c1-4-26(30(39)34-22-12-15-36(16-13-22)18-21-8-6-5-7-9-21)35-29-27(20(2)3)33-14-17-37(29)19-23-24(31)10-11-25(32)28(23)38/h4-11,22,33,38H,12-19H2,1-3H3,(H,34,39)/b26-4-,35-29- |
| InChIKey | RUFCHUZABMXIQA-KFIPBPBNSA-N |
| XLogP | 4.45 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|