C27H34N4O2 — CID 136634040
3-[(4-tert-butylphenyl)methoxy]-2-(5,6-diamino-4-piperidin-3-yl-2-pyridinyl)phenol (PubChem CID 136634040) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methoxy]-2-(5,6-diamino-4-piperidin-3-yl-2-pyridinyl)phenol.
| Compound Name | 3-[(4-tert-butylphenyl)methoxy]-2-(5,6-diamino-4-piperidin-3-yl-2-pyridinyl)phenol |
|---|---|
| PubChem CID | 136634040 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methoxy]-2-(5,6-diamino-4-piperidin-3-yl-2-pyridinyl)phenol |
| SMILES | CC(C)(C)c1ccc(COc2cccc(O)c2-c2cc(C3CCCNC3)c(N)c(N)n2)cc1 |
| InChI | InChI=1S/C27H34N4O2/c1-27(2,3)19-11-9-17(10-12-19)16-33-23-8-4-7-22(32)24(23)21-14-20(25(28)26(29)31-21)18-6-5-13-30-15-18/h4,7-12,14,18,30,32H,5-6,13,15-16,28H2,1-3H3,(H2,29,31) |
| InChIKey | IYVXAYNJJLQYRL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |