C25H31N3O3 — CID 157188587
2-[6-amino-5-(hydroxymethyl)-4-piperidin-3-yl-2-pyridinyl]-3-phenylmethoxyphenol;methane (PubChem CID 157188587) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[6-amino-5-(hydroxymethyl)-4-piperidin-3-yl-2-pyridinyl]-3-phenylmethoxyphenol;methane.
| Compound Name | 2-[6-amino-5-(hydroxymethyl)-4-piperidin-3-yl-2-pyridinyl]-3-phenylmethoxyphenol;methane |
|---|---|
| PubChem CID | 157188587 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[6-amino-5-(hydroxymethyl)-4-piperidin-3-yl-2-pyridinyl]-3-phenylmethoxyphenol;methane |
| SMILES | C.Nc1nc(-c2c(O)cccc2OCc2ccccc2)cc(C2CCCNC2)c1CO |
| InChI | InChI=1S/C24H27N3O3.CH4/c25-24-19(14-28)18(17-8-5-11-26-13-17)12-20(27-24)23-21(29)9-4-10-22(23)30-15-16-6-2-1-3-7-16;/h1-4,6-7,9-10,12,17,26,28-29H,5,8,11,13-15H2,(H2,25,27);1H4 |
| InChIKey | APKRBZQKMPXQBH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |