C19H18N6O4 — CID 136639020
5-[[1-(4-cyanooxan-3-yl)-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]-2-hydroxybenzamide (PubChem CID 136639020) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 5-[[1-(4-cyanooxan-3-yl)-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]-2-hydroxybenzamide.
| Compound Name | 5-[[1-(4-cyanooxan-3-yl)-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 136639020 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-[[1-(4-cyanooxan-3-yl)-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]-2-hydroxybenzamide |
| SMILES | N#CC1CCOCC1n1nc(Nc2ccc(O)c(C(N)=O)c2)c2c(=O)[nH]ccc21 |
| InChI | InChI=1S/C19H18N6O4/c20-8-10-4-6-29-9-14(10)25-13-3-5-22-19(28)16(13)18(24-25)23-11-1-2-15(26)12(7-11)17(21)27/h1-3,5,7,10,14,26H,4,6,9H2,(H2,21,27)(H,22,28)(H,23,24) |
| InChIKey | WDJGAAFHVDDMLB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|