C18H23F3N4O2 — CID 136641161
(2S)-N-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 136641161) has the molecular formula C18H23F3N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is (2S)-N-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 136641161 |
| Molecular Formula | C18H23F3N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-N-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)/C(O)=C/C(N)=N/C(=O)[C@@H]1CCCN1c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H23F3N4O2/c1-17(2,3)13(26)9-14(22)24-16(27)12-5-4-8-25(12)15-7-6-11(10-23-15)18(19,20)21/h6-7,9-10,12,26H,4-5,8H2,1-3H3,(H2,22,24,27)/b13-9-/t12-/m0/s1 |
| InChIKey | ODMXDNICFKGOBN-VWLVURMCSA-N |
| XLogP | 3.44 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|