C19H25FN4O2 — CID 91559218
N-(1-amino-4,4-dimethyl-3-oxopentylidene)-1-[5-(1-fluoroethenyl)-2-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 91559218) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is N-(1-amino-4,4-dimethyl-3-oxopentylidene)-1-[5-(1-fluoroethenyl)-2-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(1-amino-4,4-dimethyl-3-oxopentylidene)-1-[5-(1-fluoroethenyl)-2-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91559218 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(1-amino-4,4-dimethyl-3-oxopentylidene)-1-[5-(1-fluoroethenyl)-2-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | C=C(F)c1ccc(N2CCCC2C(=O)/N=C(\N)CC(=O)C(C)(C)C)nc1 |
| InChI | InChI=1S/C19H25FN4O2/c1-12(20)13-7-8-17(22-11-13)24-9-5-6-14(24)18(26)23-16(21)10-15(25)19(2,3)4/h7-8,11,14H,1,5-6,9-10H2,2-4H3,(H2,21,23,26) |
| InChIKey | DTDPNIFGKVRPPG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|