C21H20N4O2 — CID 136641839
1-(3-imidazol-1-ylpropyl)-4-phenyl-5-pyridin-4-ylpyrrole-2,3-diol (PubChem CID 136641839) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-pyridin-4-ylpyrrole-2,3-diol.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-pyridin-4-ylpyrrole-2,3-diol |
|---|---|
| PubChem CID | 136641839 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-pyridin-4-ylpyrrole-2,3-diol |
| SMILES | Oc1c(-c2ccccc2)c(-c2ccncc2)n(CCCn2ccnc2)c1O |
| InChI | InChI=1S/C21H20N4O2/c26-20-18(16-5-2-1-3-6-16)19(17-7-9-22-10-8-17)25(21(20)27)13-4-12-24-14-11-23-15-24/h1-3,5-11,14-15,26-27H,4,12-13H2 |
| InChIKey | ZVIUOUJIWOOXAY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |