C22H21N3O3 — CID 91465452
4-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-5-phenylpyrrole-2,3-diol (PubChem CID 91465452) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-5-phenylpyrrole-2,3-diol.
| Compound Name | 4-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-5-phenylpyrrole-2,3-diol |
|---|---|
| PubChem CID | 91465452 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-5-phenylpyrrole-2,3-diol |
| SMILES | Oc1ccc(-c2c(O)c(O)n(CCCn3ccnc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O3/c26-18-9-7-16(8-10-18)19-20(17-5-2-1-3-6-17)25(22(28)21(19)27)13-4-12-24-14-11-23-15-24/h1-3,5-11,14-15,26-28H,4,12-13H2 |
| InChIKey | FRCBHYPYCRVDFD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |