C23H25N5O2 — CID 136642244
3-[[[6-(4-hydroxyphenyl)pyrazin-2-yl]amino]methyl]-N-(1-methylpyrrolidin-3-yl)benzamide (PubChem CID 136642244) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 3-[[[6-(4-hydroxyphenyl)pyrazin-2-yl]amino]methyl]-N-(1-methylpyrrolidin-3-yl)benzamide.
| Compound Name | 3-[[[6-(4-hydroxyphenyl)pyrazin-2-yl]amino]methyl]-N-(1-methylpyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 136642244 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-[[[6-(4-hydroxyphenyl)pyrazin-2-yl]amino]methyl]-N-(1-methylpyrrolidin-3-yl)benzamide |
| SMILES | CN1CCC(NC(=O)c2cccc(CNc3cncc(-c4ccc(O)cc4)n3)c2)C1 |
| InChI | InChI=1S/C23H25N5O2/c1-28-10-9-19(15-28)26-23(30)18-4-2-3-16(11-18)12-25-22-14-24-13-21(27-22)17-5-7-20(29)8-6-17/h2-8,11,13-14,19,29H,9-10,12,15H2,1H3,(H,25,27)(H,26,30) |
| InChIKey | XTXXEFWKMSOVBM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |