C15H10BrN5O2S — CID 136644522
3-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzonitrile (PubChem CID 136644522) has the molecular formula C15H10BrN5O2S and a molecular weight of 404.25 g/mol. Its IUPAC name is 3-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzonitrile.
| Compound Name | 3-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 136644522 |
| Molecular Formula | C15H10BrN5O2S |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | 3-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxybenzonitrile |
| SMILES | N#Cc1cccc(NC2=NS(=O)N=C2Nc2ccccc2Br)c1O |
| InChI | InChI=1S/C15H10BrN5O2S/c16-10-5-1-2-6-11(10)18-14-15(21-24(23)20-14)19-12-7-3-4-9(8-17)13(12)22/h1-7,22H,(H,18,20)(H,19,21) |
| InChIKey | NMEVKWVPVPPGAI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|