C18H20BrN5O2S — CID 143077219
2-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-[2-(dimethylamino)ethyl]phenol (PubChem CID 143077219) has the molecular formula C18H20BrN5O2S and a molecular weight of 450.36 g/mol. Its IUPAC name is 2-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-[2-(dimethylamino)ethyl]phenol.
| Compound Name | 2-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-[2-(dimethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 143077219 |
| Molecular Formula | C18H20BrN5O2S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2-[[4-(2-bromoanilino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-[2-(dimethylamino)ethyl]phenol |
| SMILES | CN(C)CCc1cccc(NC2=NS(=O)N=C2Nc2ccccc2Br)c1O |
| InChI | InChI=1S/C18H20BrN5O2S/c1-24(2)11-10-12-6-5-9-15(16(12)25)21-18-17(22-27(26)23-18)20-14-8-4-3-7-13(14)19/h3-9,25H,10-11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | HUHOEUWCUXQVNP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|