C26H35N7O4 — CID 136645394
2-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-N-hydroxy-2,7-diazaspiro[4.5]decane-7-carboxamide (PubChem CID 136645394) has the molecular formula C26H35N7O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 2-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-N-hydroxy-2,7-diazaspiro[4.5]decane-7-carboxamide.
| Compound Name | 2-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-N-hydroxy-2,7-diazaspiro[4.5]decane-7-carboxamide |
|---|---|
| PubChem CID | 136645394 |
| Molecular Formula | C26H35N7O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 2-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]-N-hydroxy-2,7-diazaspiro[4.5]decane-7-carboxamide |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(N4CCC5(CCCN(C(=O)NO)C5)C4)ccc3OCC)nc12 |
| InChI | InChI=1S/C26H35N7O4/c1-4-7-19-21-22(31(3)29-19)24(34)28-23(27-21)18-14-17(8-9-20(18)37-5-2)32-13-11-26(15-32)10-6-12-33(16-26)25(35)30-36/h8-9,14,36H,4-7,10-13,15-16H2,1-3H3,(H,30,35)(H,27,28,34) |
| InChIKey | PICIRCUMRGWCNP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|