C30H36N6O4 — CID 136985293
4-[4-[[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxybenzamide (PubChem CID 136985293) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is 4-[4-[[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxybenzamide.
| Compound Name | 4-[4-[[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 136985293 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 4-[4-[[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxybenzamide |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(CC4CCN(c5ccc(C(=O)NO)cc5)CC4)ccc3OCC)nc12 |
| InChI | InChI=1S/C30H36N6O4/c1-4-6-24-26-27(35(3)33-24)30(38)32-28(31-26)23-18-20(7-12-25(23)40-5-2)17-19-13-15-36(16-14-19)22-10-8-21(9-11-22)29(37)34-39/h7-12,18-19,39H,4-6,13-17H2,1-3H3,(H,34,37)(H,31,32,38) |
| InChIKey | RMPUWVRSXCDITG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|